C15H18ClNO3 — CID 65069500
3-[(3-chloro-4-hydroxyphenyl)methylamino]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 65069500) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is 3-[(3-chloro-4-hydroxyphenyl)methylamino]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 3-[(3-chloro-4-hydroxyphenyl)methylamino]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 65069500 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3-[(3-chloro-4-hydroxyphenyl)methylamino]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(O)C1C2CCC(C2)C1NCc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C15H18ClNO3/c16-11-5-8(1-4-12(11)18)7-17-14-10-3-2-9(6-10)13(14)15(19)20/h1,4-5,9-10,13-14,17-18H,2-3,6-7H2,(H,19,20) |
| InChIKey | WSXASFFPSXFYHA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |