C17H21ClFNO2 — CID 69086292
ethyl (4R)-3-[(3-chloro-4-fluorophenyl)methylamino]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 69086292) has the molecular formula C17H21ClFNO2 and a molecular weight of 325.81 g/mol. Its IUPAC name is ethyl (4R)-3-[(3-chloro-4-fluorophenyl)methylamino]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | ethyl (4R)-3-[(3-chloro-4-fluorophenyl)methylamino]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 69086292 |
| Molecular Formula | C17H21ClFNO2 |
| Molecular Weight | 325.81 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | ethyl (4R)-3-[(3-chloro-4-fluorophenyl)methylamino]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCOC(=O)C1C2CC[C@H](C2)C1NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H21ClFNO2/c1-2-22-17(21)15-11-4-5-12(8-11)16(15)20-9-10-3-6-14(19)13(18)7-10/h3,6-7,11-12,15-16,20H,2,4-5,8-9H2,1H3/t11?,12-,15?,16?/m1/s1 |
| InChIKey | HNUUGLOJRDORBD-SSNITUJLSA-N |
| XLogP | 3.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.81 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |