C20H25Cl2NO4 — CID 25143943
ethyl (1S,2S,3R,4S)-3-[4-(2,4-dichlorophenoxy)butanoylamino]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 25143943) has the molecular formula C20H25Cl2NO4 and a molecular weight of 414.33 g/mol. Its IUPAC name is ethyl (1S,2S,3R,4S)-3-[4-(2,4-dichlorophenoxy)butanoylamino]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | ethyl (1S,2S,3R,4S)-3-[4-(2,4-dichlorophenoxy)butanoylamino]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 25143943 |
| Molecular Formula | C20H25Cl2NO4 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | ethyl (1S,2S,3R,4S)-3-[4-(2,4-dichlorophenoxy)butanoylamino]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2CC[C@@H](C2)[C@H]1NC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H25Cl2NO4/c1-2-26-20(25)18-12-5-6-13(10-12)19(18)23-17(24)4-3-9-27-16-8-7-14(21)11-15(16)22/h7-8,11-13,18-19H,2-6,9-10H2,1H3,(H,23,24)/t12-,13-,18-,19+/m0/s1 |
| InChIKey | AIWMCORXTJAWEA-BIPCEHGGSA-N |
| XLogP | 4.25 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|