C15H20BrNO2S — CID 103767285
1-(4-bromophenyl)-N-[2-(3-hydroxypropylsulfanyl)ethyl]cyclopropane-1-carboxamide (PubChem CID 103767285) has the molecular formula C15H20BrNO2S and a molecular weight of 358.30 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[2-(3-hydroxypropylsulfanyl)ethyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[2-(3-hydroxypropylsulfanyl)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 103767285 |
| Molecular Formula | C15H20BrNO2S |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 1-(4-bromophenyl)-N-[2-(3-hydroxypropylsulfanyl)ethyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCCSCCCO)C1(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C15H20BrNO2S/c16-13-4-2-12(3-5-13)15(6-7-15)14(19)17-8-11-20-10-1-9-18/h2-5,18H,1,6-11H2,(H,17,19) |
| InChIKey | WVMANPUAGPUTHS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|