C8H13F2NO2 — CID 103769956
N-(3,3-difluoro-2-hydroxypropyl)-3-methylbut-2-enamide (PubChem CID 103769956) has the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-3-methylbut-2-enamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 103769956 |
| Molecular Formula | C8H13F2NO2 |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)NCC(O)C(F)F |
| InChI | InChI=1S/C8H13F2NO2/c1-5(2)3-7(13)11-4-6(12)8(9)10/h3,6,8,12H,4H2,1-2H3,(H,11,13) |
| InChIKey | NKEGPGSPBRUDBA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|