C15H24ClN3O2 — CID 103770574
(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-(3-ethyl-2-hydroxypentyl)prop-2-enamide (PubChem CID 103770574) has the molecular formula C15H24ClN3O2 and a molecular weight of 313.83 g/mol. Its IUPAC name is (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-(3-ethyl-2-hydroxypentyl)prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-(3-ethyl-2-hydroxypentyl)prop-2-enamide |
|---|---|
| PubChem CID | 103770574 |
| Molecular Formula | C15H24ClN3O2 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-(3-ethyl-2-hydroxypentyl)prop-2-enamide |
| SMILES | CCC(CC)C(O)CNC(=O)/C=C/c1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C15H24ClN3O2/c1-5-11(6-2)13(20)9-17-14(21)8-7-12-10(3)18-19(4)15(12)16/h7-8,11,13,20H,5-6,9H2,1-4H3,(H,17,21)/b8-7+ |
| InChIKey | GCTVTXZAKOTCHP-BQYQJAHWSA-N |
| XLogP | 2.31 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|