C13H20ClN3O3 — CID 103890876
(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]prop-2-enamide (PubChem CID 103890876) has the molecular formula C13H20ClN3O3 and a molecular weight of 301.77 g/mol. Its IUPAC name is (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 103890876 |
| Molecular Formula | C13H20ClN3O3 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]prop-2-enamide |
| SMILES | CCC(CO)(CO)NC(=O)/C=C/c1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C13H20ClN3O3/c1-4-13(7-18,8-19)15-11(20)6-5-10-9(2)16-17(3)12(10)14/h5-6,18-19H,4,7-8H2,1-3H3,(H,15,20)/b6-5+ |
| InChIKey | MXRGVGWXEFTLIH-AATRIKPKSA-N |
| XLogP | 0.64 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|