C12H16ClN3O3 — CID 129407534
(2S)-3-[[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]amino]-2-methylpropanoic acid (PubChem CID 129407534) has the molecular formula C12H16ClN3O3 and a molecular weight of 285.73 g/mol. Its IUPAC name is (2S)-3-[[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]amino]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 129407534 |
| Molecular Formula | C12H16ClN3O3 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | (2S)-3-[[(Z)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]amino]-2-methylpropanoic acid |
| SMILES | Cc1nn(C)c(Cl)c1/C=C\C(=O)NC[C@H](C)C(=O)O |
| InChI | InChI=1S/C12H16ClN3O3/c1-7(12(18)19)6-14-10(17)5-4-9-8(2)15-16(3)11(9)13/h4-5,7H,6H2,1-3H3,(H,14,17)(H,18,19)/b5-4-/t7-/m0/s1 |
| InChIKey | JXKCIFJVUGSROO-MJSGSUOKSA-N |
| XLogP | 1.23 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|