C9H13ClN2O4 — CID 10377353
diethyl imidazol-1-ium-1,3-dicarboxylate chloride (PubChem CID 10377353) has the molecular formula C9H13ClN2O4 and a molecular weight of 248.67 g/mol. Its IUPAC name is diethyl imidazol-1-ium-1,3-dicarboxylate chloride.
| Compound Name | diethyl imidazol-1-ium-1,3-dicarboxylate chloride |
|---|---|
| PubChem CID | 10377353 |
| Molecular Formula | C9H13ClN2O4 |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | diethyl imidazol-1-ium-1,3-dicarboxylate chloride |
| SMILES | CCOC(=O)n1cc[n+](C(=O)OCC)c1.[Cl-] |
| InChI | InChI=1S/C9H13N2O4.ClH/c1-3-14-8(12)10-5-6-11(7-10)9(13)15-4-2;/h5-7H,3-4H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | HYNBIZPEVORSBC-UHFFFAOYSA-M |
| XLogP | -2.21 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|