About ethyl 4-[hydroxy(dimethoxy)-λ5-phosphanylidene]pyridine-1-carboxylate
ethyl 4-[hydroxy(dimethoxy)-λ5-phosphanylidene]pyridine-1-carboxylate (PubChem CID 57245544) has the molecular formula C10H16NO5P
and a molecular weight of 261.21 g/mol. Its IUPAC name is ethyl 4-[hydroxy(dimethoxy)-λ5-phosphanylidene]pyridine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[hydroxy(dimethoxy)-λ5-phosphanylidene]pyridine-1-carboxylate |
| PubChem CID | 57245544 |
| Molecular Formula | C10H16NO5P |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | ethyl 4-[hydroxy(dimethoxy)-λ5-phosphanylidene]pyridine-1-carboxylate |
| SMILES | CCOC(=O)n1ccc(=P(O)(OC)OC)cc1 |
| InChI | InChI=1S/C10H16NO5P/c1-4-16-10(12)11-7-5-9(6-8-11)17(13,14-2)15-3/h5-8,13H,4H2,1-3H3 |
| InChIKey | JUBGCNAOPASVCP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[hydroxy(dimethoxy)-λ5-phosphanylidene]pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[hydroxy(dimethoxy)-λ5-phosphanylidene]pyridine-1-carboxylate?
The IUPAC name of ethyl 4-[hydroxy(dimethoxy)-λ5-phosphanylidene]pyridine-1-carboxylate (CID 57245544) is ethyl 4-[hydroxy(dimethoxy)-λ5-phosphanylidene]pyridine-1-carboxylate.
What is the SMILES notation for ethyl 4-[hydroxy(dimethoxy)-λ5-phosphanylidene]pyridine-1-carboxylate?
The canonical SMILES for ethyl 4-[hydroxy(dimethoxy)-λ5-phosphanylidene]pyridine-1-carboxylate is CCOC(=O)n1ccc(=P(O)(OC)OC)cc1.
What is the InChIKey of ethyl 4-[hydroxy(dimethoxy)-λ5-phosphanylidene]pyridine-1-carboxylate?
The InChIKey is JUBGCNAOPASVCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16NO5P/c1-4-16-10(12)11-7-5-9(6-8-11)17(13,14-2)15-3/h5-8,13H,4H2,1-3H3.
What are the key properties of ethyl 4-[hydroxy(dimethoxy)-λ5-phosphanylidene]pyridine-1-carboxylate?
ethyl 4-[hydroxy(dimethoxy)-λ5-phosphanylidene]pyridine-1-carboxylate has a molecular weight of 261.21 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[hydroxy(dimethoxy)-λ5-phosphanylidene]pyridine-1-carboxylate is sourced from PubChem (CID 57245544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).