C12H16BrNOS — CID 103778295
[(1R,4S)-4-[(5-bromo-4-methylthiophen-2-yl)methylamino]cyclopent-2-en-1-yl]methanol (PubChem CID 103778295) has the molecular formula C12H16BrNOS and a molecular weight of 302.24 g/mol. Its IUPAC name is [(1R,4S)-4-[(5-bromo-4-methylthiophen-2-yl)methylamino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[(5-bromo-4-methylthiophen-2-yl)methylamino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 103778295 |
| Molecular Formula | C12H16BrNOS |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | [(1R,4S)-4-[(5-bromo-4-methylthiophen-2-yl)methylamino]cyclopent-2-en-1-yl]methanol |
| SMILES | Cc1cc(CN[C@@H]2C=C[C@H](CO)C2)sc1Br |
| InChI | InChI=1S/C12H16BrNOS/c1-8-4-11(16-12(8)13)6-14-10-3-2-9(5-10)7-15/h2-4,9-10,14-15H,5-7H2,1H3/t9-,10+/m0/s1 |
| InChIKey | KAHJMQUSVPOZLH-VHSXEESVSA-N |
| XLogP | 2.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|