C17H25BrN2O2 — CID 103780185
tert-butyl N-[2-[(6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)amino]ethyl]carbamate (PubChem CID 103780185) has the molecular formula C17H25BrN2O2 and a molecular weight of 369.30 g/mol. Its IUPAC name is tert-butyl N-[2-[(6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 103780185 |
| Molecular Formula | C17H25BrN2O2 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | tert-butyl N-[2-[(6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC1CCc2cc(Br)ccc2C1 |
| InChI | InChI=1S/C17H25BrN2O2/c1-17(2,3)22-16(21)20-9-8-19-15-7-5-12-10-14(18)6-4-13(12)11-15/h4,6,10,15,19H,5,7-9,11H2,1-3H3,(H,20,21) |
| InChIKey | JAFRVCJYMVNJAS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|