C11H19F3N2S — CID 103780268
N-(thiolan-3-yl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine (PubChem CID 103780268) has the molecular formula C11H19F3N2S and a molecular weight of 268.35 g/mol. Its IUPAC name is N-(thiolan-3-yl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine.
| Compound Name | N-(thiolan-3-yl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 103780268 |
| Molecular Formula | C11H19F3N2S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-(thiolan-3-yl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
| SMILES | FC(F)(F)CN1CCC(NC2CCSC2)CC1 |
| InChI | InChI=1S/C11H19F3N2S/c12-11(13,14)8-16-4-1-9(2-5-16)15-10-3-6-17-7-10/h9-10,15H,1-8H2 |
| InChIKey | CQLSOHZPDDCTCI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |