C18H28N2O2S — CID 103781269
tert-butyl N-[3-(3,4-dihydro-1H-isothiochromen-4-ylamino)propyl]-N-methylcarbamate (PubChem CID 103781269) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is tert-butyl N-[3-(3,4-dihydro-1H-isothiochromen-4-ylamino)propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-(3,4-dihydro-1H-isothiochromen-4-ylamino)propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 103781269 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | tert-butyl N-[3-(3,4-dihydro-1H-isothiochromen-4-ylamino)propyl]-N-methylcarbamate |
| SMILES | CN(CCCNC1CSCc2ccccc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N2O2S/c1-18(2,3)22-17(21)20(4)11-7-10-19-16-13-23-12-14-8-5-6-9-15(14)16/h5-6,8-9,16,19H,7,10-13H2,1-4H3 |
| InChIKey | QOCDGDNDYOBGFS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|