C14H21N5OS — CID 103785088
2-methylsulfanyl-3-[1-[3-(tetrazol-1-yl)phenyl]ethylamino]butan-1-ol (PubChem CID 103785088) has the molecular formula C14H21N5OS and a molecular weight of 307.42 g/mol. Its IUPAC name is 2-methylsulfanyl-3-[1-[3-(tetrazol-1-yl)phenyl]ethylamino]butan-1-ol.
| Compound Name | 2-methylsulfanyl-3-[1-[3-(tetrazol-1-yl)phenyl]ethylamino]butan-1-ol |
|---|---|
| PubChem CID | 103785088 |
| Molecular Formula | C14H21N5OS |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-methylsulfanyl-3-[1-[3-(tetrazol-1-yl)phenyl]ethylamino]butan-1-ol |
| SMILES | CSC(CO)C(C)NC(C)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C14H21N5OS/c1-10(16-11(2)14(8-20)21-3)12-5-4-6-13(7-12)19-9-15-17-18-19/h4-7,9-11,14,16,20H,8H2,1-3H3 |
| InChIKey | LKXMCAGNRJQCPM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |