C12H23NO2S2 — CID 103801422
N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-(thian-4-yl)acetamide (PubChem CID 103801422) has the molecular formula C12H23NO2S2 and a molecular weight of 277.45 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-(thian-4-yl)acetamide.
| Compound Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-(thian-4-yl)acetamide |
|---|---|
| PubChem CID | 103801422 |
| Molecular Formula | C12H23NO2S2 |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-(thian-4-yl)acetamide |
| SMILES | CSC(CO)C(C)NC(=O)CC1CCSCC1 |
| InChI | InChI=1S/C12H23NO2S2/c1-9(11(8-14)16-2)13-12(15)7-10-3-5-17-6-4-10/h9-11,14H,3-8H2,1-2H3,(H,13,15) |
| InChIKey | QIKLLKJYAVEBAQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |