C11H21NO3S — CID 103801459
N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-3-methyloxolane-2-carboxamide (PubChem CID 103801459) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-3-methyloxolane-2-carboxamide.
| Compound Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-3-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 103801459 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-3-methyloxolane-2-carboxamide |
| SMILES | CSC(CO)C(C)NC(=O)C1OCCC1C |
| InChI | InChI=1S/C11H21NO3S/c1-7-4-5-15-10(7)11(14)12-8(2)9(6-13)16-3/h7-10,13H,4-6H2,1-3H3,(H,12,14) |
| InChIKey | QMLPCYNZRBDITK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |