C12H21N3O4S — CID 103802783
2-[2-(dimethylamino)ethyl-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]amino]acetic acid (PubChem CID 103802783) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]amino]acetic acid.
| Compound Name | 2-[2-(dimethylamino)ethyl-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 103802783 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]amino]acetic acid |
| SMILES | CN(C)CCN(CC(=O)O)C(=O)CCN1CCSC1=O |
| InChI | InChI=1S/C12H21N3O4S/c1-13(2)5-6-15(9-11(17)18)10(16)3-4-14-7-8-20-12(14)19/h3-9H2,1-2H3,(H,17,18) |
| InChIKey | WVOCDOSAPATTEO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|