C15H24N2O2 — CID 103811917
2-anilino-N-(2-hydroxy-4,4-dimethylpentyl)acetamide (PubChem CID 103811917) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-anilino-N-(2-hydroxy-4,4-dimethylpentyl)acetamide.
| Compound Name | 2-anilino-N-(2-hydroxy-4,4-dimethylpentyl)acetamide |
|---|---|
| PubChem CID | 103811917 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-anilino-N-(2-hydroxy-4,4-dimethylpentyl)acetamide |
| SMILES | CC(C)(C)CC(O)CNC(=O)CNc1ccccc1 |
| InChI | InChI=1S/C15H24N2O2/c1-15(2,3)9-13(18)10-17-14(19)11-16-12-7-5-4-6-8-12/h4-8,13,16,18H,9-11H2,1-3H3,(H,17,19) |
| InChIKey | NRDFSFAPTCKRJC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |