C17H25NO3S — CID 10381548
(2R,3R)-2-[(3-nitrophenoxy)methyl]-3-octylthiirane (PubChem CID 10381548) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is (2R,3R)-2-[(3-nitrophenoxy)methyl]-3-octylthiirane.
| Compound Name | (2R,3R)-2-[(3-nitrophenoxy)methyl]-3-octylthiirane |
|---|---|
| PubChem CID | 10381548 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (2R,3R)-2-[(3-nitrophenoxy)methyl]-3-octylthiirane |
| SMILES | CCCCCCCC[C@H]1S[C@@H]1COc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H25NO3S/c1-2-3-4-5-6-7-11-16-17(22-16)13-21-15-10-8-9-14(12-15)18(19)20/h8-10,12,16-17H,2-7,11,13H2,1H3/t16-,17-/m1/s1 |
| InChIKey | RSSXMEUOLDHTFN-IAGOWNOFSA-N |
| XLogP | 5.21 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|