C16H24BrNO2 — CID 103820505
3-(4-bromophenyl)-N-(1-hydroxy-4-methylpentan-3-yl)butanamide (PubChem CID 103820505) has the molecular formula C16H24BrNO2 and a molecular weight of 342.28 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-(1-hydroxy-4-methylpentan-3-yl)butanamide.
| Compound Name | 3-(4-bromophenyl)-N-(1-hydroxy-4-methylpentan-3-yl)butanamide |
|---|---|
| PubChem CID | 103820505 |
| Molecular Formula | C16H24BrNO2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 3-(4-bromophenyl)-N-(1-hydroxy-4-methylpentan-3-yl)butanamide |
| SMILES | CC(CC(=O)NC(CCO)C(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H24BrNO2/c1-11(2)15(8-9-19)18-16(20)10-12(3)13-4-6-14(17)7-5-13/h4-7,11-12,15,19H,8-10H2,1-3H3,(H,18,20) |
| InChIKey | RVTFANJWXVMOOO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |