C23H24N4O4S — CID 103821043
2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(4-methyl-1,2,4-triazol-3-yl)methylsulfanyl]butanoic acid (PubChem CID 103821043) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(4-methyl-1,2,4-triazol-3-yl)methylsulfanyl]butanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(4-methyl-1,2,4-triazol-3-yl)methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 103821043 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(4-methyl-1,2,4-triazol-3-yl)methylsulfanyl]butanoic acid |
| SMILES | Cn1cnnc1CSCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C23H24N4O4S/c1-27-14-24-26-21(27)13-32-11-10-20(22(28)29)25-23(30)31-12-19-17-8-4-2-6-15(17)16-7-3-5-9-18(16)19/h2-9,14,19-20H,10-13H2,1H3,(H,25,30)(H,28,29) |
| InChIKey | RJNGCURBBCWPSX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|