C28H27N3O4S — CID 113242271
2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(1-methylindazol-3-yl)methylsulfanyl]butanoic acid (PubChem CID 113242271) has the molecular formula C28H27N3O4S and a molecular weight of 501.61 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(1-methylindazol-3-yl)methylsulfanyl]butanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(1-methylindazol-3-yl)methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 113242271 |
| Molecular Formula | C28H27N3O4S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(1-methylindazol-3-yl)methylsulfanyl]butanoic acid |
| SMILES | Cn1nc(CSCCC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C28H27N3O4S/c1-31-26-13-7-6-12-22(26)25(30-31)17-36-15-14-24(27(32)33)29-28(34)35-16-23-20-10-4-2-8-18(20)19-9-3-5-11-21(19)23/h2-13,23-24H,14-17H2,1H3,(H,29,34)(H,32,33) |
| InChIKey | PQMTUANAVWDAEE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|