C10H19NO4S — CID 103822681
[4-[(1,1-dioxothiolan-3-yl)amino]oxan-4-yl]methanol (PubChem CID 103822681) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is [4-[(1,1-dioxothiolan-3-yl)amino]oxan-4-yl]methanol.
| Compound Name | [4-[(1,1-dioxothiolan-3-yl)amino]oxan-4-yl]methanol |
|---|---|
| PubChem CID | 103822681 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | [4-[(1,1-dioxothiolan-3-yl)amino]oxan-4-yl]methanol |
| SMILES | O=S1(=O)CCC(NC2(CO)CCOCC2)C1 |
| InChI | InChI=1S/C10H19NO4S/c12-8-10(2-4-15-5-3-10)11-9-1-6-16(13,14)7-9/h9,11-12H,1-8H2 |
| InChIKey | ZNGASOGNPKCBCC-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |