C17H23NO4S — CID 110090611
4-benzyl-N-(1,1-dioxothiolan-3-yl)oxane-4-carboxamide (PubChem CID 110090611) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is 4-benzyl-N-(1,1-dioxothiolan-3-yl)oxane-4-carboxamide.
| Compound Name | 4-benzyl-N-(1,1-dioxothiolan-3-yl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 110090611 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 4-benzyl-N-(1,1-dioxothiolan-3-yl)oxane-4-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)C1(Cc2ccccc2)CCOCC1 |
| InChI | InChI=1S/C17H23NO4S/c19-16(18-15-6-11-23(20,21)13-15)17(7-9-22-10-8-17)12-14-4-2-1-3-5-14/h1-5,15H,6-13H2,(H,18,19) |
| InChIKey | QDFDTTVHNARGTA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |