C14H20Cl2N2O — CID 103822854
3-[1-(3,4-dichlorophenyl)ethylamino]-N,2,2-trimethylpropanamide (PubChem CID 103822854) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is 3-[1-(3,4-dichlorophenyl)ethylamino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[1-(3,4-dichlorophenyl)ethylamino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 103822854 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 3-[1-(3,4-dichlorophenyl)ethylamino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNC(C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H20Cl2N2O/c1-9(10-5-6-11(15)12(16)7-10)18-8-14(2,3)13(19)17-4/h5-7,9,18H,8H2,1-4H3,(H,17,19) |
| InChIKey | ZRGVMGSXDFTSCE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |