C19H18N6O — CID 10382985
1-benzyl-4-[[(1S)-1-phenylethyl]amino]-6H-triazolo[4,5-d]pyridazin-7-one (PubChem CID 10382985) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-benzyl-4-[[(1S)-1-phenylethyl]amino]-6H-triazolo[4,5-d]pyridazin-7-one.
| Compound Name | 1-benzyl-4-[[(1S)-1-phenylethyl]amino]-6H-triazolo[4,5-d]pyridazin-7-one |
|---|---|
| PubChem CID | 10382985 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-benzyl-4-[[(1S)-1-phenylethyl]amino]-6H-triazolo[4,5-d]pyridazin-7-one |
| SMILES | C[C@H](Nc1n[nH]c(=O)c2c1nnn2Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18N6O/c1-13(15-10-6-3-7-11-15)20-18-16-17(19(26)23-22-18)25(24-21-16)12-14-8-4-2-5-9-14/h2-11,13H,12H2,1H3,(H,20,22)(H,23,26)/t13-/m0/s1 |
| InChIKey | VOJOIAOGBPBRML-ZDUSSCGKSA-N |
| XLogP | 2.74 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |