C18H17N7O — CID 10617639
1-(1-phenylethyl)-4-(2-phenylhydrazinyl)-6H-triazolo[4,5-d]pyridazin-7-one (PubChem CID 10617639) has the molecular formula C18H17N7O and a molecular weight of 347.38 g/mol. Its IUPAC name is 1-(1-phenylethyl)-4-(2-phenylhydrazinyl)-6H-triazolo[4,5-d]pyridazin-7-one.
| Compound Name | 1-(1-phenylethyl)-4-(2-phenylhydrazinyl)-6H-triazolo[4,5-d]pyridazin-7-one |
|---|---|
| PubChem CID | 10617639 |
| Molecular Formula | C18H17N7O |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 1-(1-phenylethyl)-4-(2-phenylhydrazinyl)-6H-triazolo[4,5-d]pyridazin-7-one |
| SMILES | CC(c1ccccc1)n1nnc2c(NNc3ccccc3)n[nH]c(=O)c21 |
| InChI | InChI=1S/C18H17N7O/c1-12(13-8-4-2-5-9-13)25-16-15(20-24-25)17(22-23-18(16)26)21-19-14-10-6-3-7-11-14/h2-12,19H,1H3,(H,21,22)(H,23,26) |
| InChIKey | LPNOAQVSUUOAJX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|