C15H17N5O3 — CID 136880499
7-(2-methoxyethoxy)-3-(1-phenylethyl)-5H-pyrazolo[4,3-d]triazin-4-one (PubChem CID 136880499) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is 7-(2-methoxyethoxy)-3-(1-phenylethyl)-5H-pyrazolo[4,3-d]triazin-4-one.
| Compound Name | 7-(2-methoxyethoxy)-3-(1-phenylethyl)-5H-pyrazolo[4,3-d]triazin-4-one |
|---|---|
| PubChem CID | 136880499 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 7-(2-methoxyethoxy)-3-(1-phenylethyl)-5H-pyrazolo[4,3-d]triazin-4-one |
| SMILES | COCCOc1n[nH]c2c(=O)n(C(C)c3ccccc3)nnc12 |
| InChI | InChI=1S/C15H17N5O3/c1-10(11-6-4-3-5-7-11)20-15(21)13-12(17-19-20)14(18-16-13)23-9-8-22-2/h3-7,10H,8-9H2,1-2H3,(H,16,18) |
| InChIKey | VMXVOBDCALRCET-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|