C15H18N6O — CID 10402423
1-benzyl-4-(diethylamino)-6H-triazolo[4,5-d]pyridazin-7-one (PubChem CID 10402423) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is 1-benzyl-4-(diethylamino)-6H-triazolo[4,5-d]pyridazin-7-one.
| Compound Name | 1-benzyl-4-(diethylamino)-6H-triazolo[4,5-d]pyridazin-7-one |
|---|---|
| PubChem CID | 10402423 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-benzyl-4-(diethylamino)-6H-triazolo[4,5-d]pyridazin-7-one |
| SMILES | CCN(CC)c1n[nH]c(=O)c2c1nnn2Cc1ccccc1 |
| InChI | InChI=1S/C15H18N6O/c1-3-20(4-2)14-12-13(15(22)18-17-14)21(19-16-12)10-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3,(H,18,22) |
| InChIKey | YJWKNEUMTDTIKP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |