C19H16N7O+ — CID 10689672
5-[(4-methylphenyl)methyl]-11-phenyl-3,4,5,8,9,12-hexaza-11-azoniatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,10-tetraen-7-one (PubChem CID 10689672) has the molecular formula C19H16N7O+ and a molecular weight of 358.39 g/mol. Its IUPAC name is 5-[(4-methylphenyl)methyl]-11-phenyl-3,4,5,8,9,12-hexaza-11-azoniatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,10-tetraen-7-one.
| Compound Name | 5-[(4-methylphenyl)methyl]-11-phenyl-3,4,5,8,9,12-hexaza-11-azoniatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,10-tetraen-7-one |
|---|---|
| PubChem CID | 10689672 |
| Molecular Formula | C19H16N7O+ |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 5-[(4-methylphenyl)methyl]-11-phenyl-3,4,5,8,9,12-hexaza-11-azoniatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,10-tetraen-7-one |
| SMILES | Cc1ccc(Cn2nnc3c2c(=O)[nH]n2c[n+](-c4ccccc4)nc32)cc1 |
| InChI | InChI=1S/C19H15N7O/c1-13-7-9-14(10-8-13)11-24-17-16(20-23-24)18-21-25(12-26(18)22-19(17)27)15-5-3-2-4-6-15/h2-10,12H,11H2,1H3/p+1 |
| InChIKey | WMDFTYORMBZRQF-UHFFFAOYSA-O |
| XLogP | 1.40 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|