C49H37N7S — CID 136509643
4-[7-benzyl-8-[4-(N-phenylanilino)phenyl]-1,3-dihydrotriazolo[4,5-f][2,1,3]benzothiadiazol-4-yl]-N,N-diphenylaniline (PubChem CID 136509643) has the molecular formula C49H37N7S and a molecular weight of 755.95 g/mol. Its IUPAC name is 4-[7-benzyl-8-[4-(N-phenylanilino)phenyl]-1,3-dihydrotriazolo[4,5-f][2,1,3]benzothiadiazol-4-yl]-N,N-diphenylaniline.
| Compound Name | 4-[7-benzyl-8-[4-(N-phenylanilino)phenyl]-1,3-dihydrotriazolo[4,5-f][2,1,3]benzothiadiazol-4-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 136509643 |
| Molecular Formula | C49H37N7S |
| Molecular Weight | 755.95 g/mol |
| Exact Mass | 755.28 |
| IUPAC Name | 4-[7-benzyl-8-[4-(N-phenylanilino)phenyl]-1,3-dihydrotriazolo[4,5-f][2,1,3]benzothiadiazol-4-yl]-N,N-diphenylaniline |
| SMILES | c1ccc(Cn2nnc3c(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)c4c(c(-c5ccc(N(c6ccccc6)c6ccccc6)cc5)c32)NSN4)cc1 |
| InChI | InChI=1S/C49H37N7S/c1-6-16-35(17-7-1)34-54-49-45(37-28-32-43(33-29-37)56(40-22-12-4-13-23-40)41-24-14-5-15-25-41)47-46(51-57-52-47)44(48(49)50-53-54)36-26-30-42(31-27-36)55(38-18-8-2-9-19-38)39-20-10-3-11-21-39/h1-33,51-52H,34H2 |
| InChIKey | YSCFGKQDCUKXGX-UHFFFAOYSA-N |
| XLogP | 13.15 |
| TPSA | 61.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.95 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|