C20H28O5 — CID 10383128
methyl (4S,4aR,5S,6R,8aR)-5-[2-(furan-3-yl)ethyl]-4-hydroxy-6-(hydroxymethyl)-8a-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalene-1-carboxylate (PubChem CID 10383128) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is methyl (4S,4aR,5S,6R,8aR)-5-[2-(furan-3-yl)ethyl]-4-hydroxy-6-(hydroxymethyl)-8a-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalene-1-carboxylate.
| Compound Name | methyl (4S,4aR,5S,6R,8aR)-5-[2-(furan-3-yl)ethyl]-4-hydroxy-6-(hydroxymethyl)-8a-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 10383128 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | methyl (4S,4aR,5S,6R,8aR)-5-[2-(furan-3-yl)ethyl]-4-hydroxy-6-(hydroxymethyl)-8a-methyl-4,4a,5,6,7,8-hexahydro-3H-naphthalene-1-carboxylate |
| SMILES | COC(=O)C1=CC[C@H](O)[C@@H]2[C@@H](CCc3ccoc3)[C@H](CO)CC[C@@]12C |
| InChI | InChI=1S/C20H28O5/c1-20-9-7-14(11-21)15(4-3-13-8-10-25-12-13)18(20)17(22)6-5-16(20)19(23)24-2/h5,8,10,12,14-15,17-18,21-22H,3-4,6-7,9,11H2,1-2H3/t14-,15-,17-,18-,20-/m0/s1 |
| InChIKey | CBWDTDLEBVVBMS-FKWRQYOWSA-N |
| XLogP | 2.72 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |