C22H17N5 — CID 10383308
12-(4-methylphenyl)-2,3,7,13-tetrazatetracyclo[12.4.0.02,6.07,11]octadeca-1(18),3,5,8,10,14,16-heptaene-5-carbonitrile (PubChem CID 10383308) has the molecular formula C22H17N5 and a molecular weight of 351.41 g/mol. Its IUPAC name is 12-(4-methylphenyl)-2,3,7,13-tetrazatetracyclo[12.4.0.02,6.07,11]octadeca-1(18),3,5,8,10,14,16-heptaene-5-carbonitrile.
| Compound Name | 12-(4-methylphenyl)-2,3,7,13-tetrazatetracyclo[12.4.0.02,6.07,11]octadeca-1(18),3,5,8,10,14,16-heptaene-5-carbonitrile |
|---|---|
| PubChem CID | 10383308 |
| Molecular Formula | C22H17N5 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 12-(4-methylphenyl)-2,3,7,13-tetrazatetracyclo[12.4.0.02,6.07,11]octadeca-1(18),3,5,8,10,14,16-heptaene-5-carbonitrile |
| SMILES | Cc1ccc(C2Nc3ccccc3-n3ncc(C#N)c3-n3cccc32)cc1 |
| InChI | InChI=1S/C22H17N5/c1-15-8-10-16(11-9-15)21-20-7-4-12-26(20)22-17(13-23)14-24-27(22)19-6-3-2-5-18(19)25-21/h2-12,14,21,25H,1H3 |
| InChIKey | BOQCFWRBNLLTEI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 58.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |