C16H13N3 — CID 6927995
(4R)-4-pyridin-2-yl-4,5-dihydropyrrolo[1,2-a]quinoxaline (PubChem CID 6927995) has the molecular formula C16H13N3 and a molecular weight of 247.30 g/mol. Its IUPAC name is (4R)-4-pyridin-2-yl-4,5-dihydropyrrolo[1,2-a]quinoxaline.
| Compound Name | (4R)-4-pyridin-2-yl-4,5-dihydropyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 6927995 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | (4R)-4-pyridin-2-yl-4,5-dihydropyrrolo[1,2-a]quinoxaline |
| SMILES | c1ccc([C@@H]2Nc3ccccc3-n3cccc32)nc1 |
| InChI | InChI=1S/C16H13N3/c1-2-8-14-12(6-1)18-16(13-7-3-4-10-17-13)15-9-5-11-19(14)15/h1-11,16,18H/t16-/m0/s1 |
| InChIKey | BILWKZNGYDFVED-INIZCTEOSA-N |
| XLogP | 3.39 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |