C21H22N4S — CID 133221611
1-ethyl-5-[1-(2-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133221611) has the molecular formula C21H22N4S and a molecular weight of 362.50 g/mol. Its IUPAC name is 1-ethyl-5-[1-(2-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-ethyl-5-[1-(2-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133221611 |
| Molecular Formula | C21H22N4S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1-ethyl-5-[1-(2-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCN1C(=S)NC(c2ccccn2)C1c1cccn1-c1ccccc1C |
| InChI | InChI=1S/C21H22N4S/c1-3-24-20(19(23-21(24)26)16-10-6-7-13-22-16)18-12-8-14-25(18)17-11-5-4-9-15(17)2/h4-14,19-20H,3H2,1-2H3,(H,23,26) |
| InChIKey | RABUOTXTNNMQJC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|