C13H12FNO5S — CID 103833532
methyl 4-fluoro-2-(furan-3-ylmethylsulfamoyl)benzoate (PubChem CID 103833532) has the molecular formula C13H12FNO5S and a molecular weight of 313.31 g/mol. Its IUPAC name is methyl 4-fluoro-2-(furan-3-ylmethylsulfamoyl)benzoate.
| Compound Name | methyl 4-fluoro-2-(furan-3-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 103833532 |
| Molecular Formula | C13H12FNO5S |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | methyl 4-fluoro-2-(furan-3-ylmethylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(F)cc1S(=O)(=O)NCc1ccoc1 |
| InChI | InChI=1S/C13H12FNO5S/c1-19-13(16)11-3-2-10(14)6-12(11)21(17,18)15-7-9-4-5-20-8-9/h2-6,8,15H,7H2,1H3 |
| InChIKey | BJUWQIKXLVOBHR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |