C8H15F2NO3S — CID 103834568
1-[1-(difluoromethylsulfonyl)piperidin-4-yl]ethanol (PubChem CID 103834568) has the molecular formula C8H15F2NO3S and a molecular weight of 243.27 g/mol. Its IUPAC name is 1-[1-(difluoromethylsulfonyl)piperidin-4-yl]ethanol.
| Compound Name | 1-[1-(difluoromethylsulfonyl)piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 103834568 |
| Molecular Formula | C8H15F2NO3S |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 1-[1-(difluoromethylsulfonyl)piperidin-4-yl]ethanol |
| SMILES | CC(O)C1CCN(S(=O)(=O)C(F)F)CC1 |
| InChI | InChI=1S/C8H15F2NO3S/c1-6(12)7-2-4-11(5-3-7)15(13,14)8(9)10/h6-8,12H,2-5H2,1H3 |
| InChIKey | BHHWHCFXADUSAS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |