C9H15F3INO3S — CID 90048053
[2,2,2-trifluoro-1-(4-methyl-1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite (PubChem CID 90048053) has the molecular formula C9H15F3INO3S and a molecular weight of 401.19 g/mol. Its IUPAC name is [2,2,2-trifluoro-1-(4-methyl-1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite.
| Compound Name | [2,2,2-trifluoro-1-(4-methyl-1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite |
|---|---|
| PubChem CID | 90048053 |
| Molecular Formula | C9H15F3INO3S |
| Molecular Weight | 401.19 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | [2,2,2-trifluoro-1-(4-methyl-1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite |
| SMILES | CC1(C(OI)C(F)(F)F)CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C9H15F3INO3S/c1-8(7(17-13)9(10,11)12)3-5-14(6-4-8)18(2,15)16/h7H,3-6H2,1-2H3 |
| InChIKey | DALCFULGDHKZCX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.19 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|