C7H16F2N2O3S — CID 103836857
3-(diethylsulfamoylamino)-1,1-difluoro-2-hydroxypropane (PubChem CID 103836857) has the molecular formula C7H16F2N2O3S and a molecular weight of 246.28 g/mol. Its IUPAC name is 3-(diethylsulfamoylamino)-1,1-difluoro-2-hydroxypropane.
| Compound Name | 3-(diethylsulfamoylamino)-1,1-difluoro-2-hydroxypropane |
|---|---|
| PubChem CID | 103836857 |
| Molecular Formula | C7H16F2N2O3S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3-(diethylsulfamoylamino)-1,1-difluoro-2-hydroxypropane |
| SMILES | CCN(CC)S(=O)(=O)NCC(O)C(F)F |
| InChI | InChI=1S/C7H16F2N2O3S/c1-3-11(4-2)15(13,14)10-5-6(12)7(8)9/h6-7,10,12H,3-5H2,1-2H3 |
| InChIKey | PCNDRNOEUAZKIO-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |