C10H19N3 — CID 103837179
2-[(1-cyclopropylcyclopropyl)methyl]-1-ethylguanidine (PubChem CID 103837179) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-[(1-cyclopropylcyclopropyl)methyl]-1-ethylguanidine.
| Compound Name | 2-[(1-cyclopropylcyclopropyl)methyl]-1-ethylguanidine |
|---|---|
| PubChem CID | 103837179 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 2-[(1-cyclopropylcyclopropyl)methyl]-1-ethylguanidine |
| SMILES | CCN/C(N)=N/CC1(C2CC2)CC1 |
| InChI | InChI=1S/C10H19N3/c1-2-12-9(11)13-7-10(5-6-10)8-3-4-8/h8H,2-7H2,1H3,(H3,11,12,13) |
| InChIKey | RWRIQDYKVIWEAR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|