C10H17F4NO2 — CID 103843283
N-[2-ethyl-2-(hydroxymethyl)butyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103843283) has the molecular formula C10H17F4NO2 and a molecular weight of 259.24 g/mol. Its IUPAC name is N-[2-ethyl-2-(hydroxymethyl)butyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[2-ethyl-2-(hydroxymethyl)butyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103843283 |
| Molecular Formula | C10H17F4NO2 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-[2-ethyl-2-(hydroxymethyl)butyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | CCC(CC)(CO)CNC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H17F4NO2/c1-3-9(4-2,6-16)5-15-8(17)10(13,14)7(11)12/h7,16H,3-6H2,1-2H3,(H,15,17) |
| InChIKey | NTMQSZSKRZLSDV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|