C14H27NO3 — CID 103843667
N-[2-ethyl-2-(hydroxymethyl)butyl]-2-(oxan-2-yl)acetamide (PubChem CID 103843667) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is N-[2-ethyl-2-(hydroxymethyl)butyl]-2-(oxan-2-yl)acetamide.
| Compound Name | N-[2-ethyl-2-(hydroxymethyl)butyl]-2-(oxan-2-yl)acetamide |
|---|---|
| PubChem CID | 103843667 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | N-[2-ethyl-2-(hydroxymethyl)butyl]-2-(oxan-2-yl)acetamide |
| SMILES | CCC(CC)(CO)CNC(=O)CC1CCCCO1 |
| InChI | InChI=1S/C14H27NO3/c1-3-14(4-2,11-16)10-15-13(17)9-12-7-5-6-8-18-12/h12,16H,3-11H2,1-2H3,(H,15,17) |
| InChIKey | RWGCPEKEUGXTOO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |