C13H24ClNO2 — CID 106144658
N-(5-chloro-2,2-dimethylpentyl)-2-(oxolan-2-yl)acetamide (PubChem CID 106144658) has the molecular formula C13H24ClNO2 and a molecular weight of 261.79 g/mol. Its IUPAC name is N-(5-chloro-2,2-dimethylpentyl)-2-(oxolan-2-yl)acetamide.
| Compound Name | N-(5-chloro-2,2-dimethylpentyl)-2-(oxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 106144658 |
| Molecular Formula | C13H24ClNO2 |
| Molecular Weight | 261.79 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-(5-chloro-2,2-dimethylpentyl)-2-(oxolan-2-yl)acetamide |
| SMILES | CC(C)(CCCCl)CNC(=O)CC1CCCO1 |
| InChI | InChI=1S/C13H24ClNO2/c1-13(2,6-4-7-14)10-15-12(16)9-11-5-3-8-17-11/h11H,3-10H2,1-2H3,(H,15,16) |
| InChIKey | PZOTUQMHFQPMFO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.79 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|