C11H20ClNO2 — CID 115364529
N-(3-chloro-2,2-dimethylpropyl)-2-(oxolan-2-yl)acetamide (PubChem CID 115364529) has the molecular formula C11H20ClNO2 and a molecular weight of 233.74 g/mol. Its IUPAC name is N-(3-chloro-2,2-dimethylpropyl)-2-(oxolan-2-yl)acetamide.
| Compound Name | N-(3-chloro-2,2-dimethylpropyl)-2-(oxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 115364529 |
| Molecular Formula | C11H20ClNO2 |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-(3-chloro-2,2-dimethylpropyl)-2-(oxolan-2-yl)acetamide |
| SMILES | CC(C)(CCl)CNC(=O)CC1CCCO1 |
| InChI | InChI=1S/C11H20ClNO2/c1-11(2,7-12)8-13-10(14)6-9-4-3-5-15-9/h9H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | RQUTZCWHPPJWFE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|