C14H22N2O3 — CID 103844394
methyl 4-[[2-ethyl-2-(hydroxymethyl)butyl]amino]pyridine-2-carboxylate (PubChem CID 103844394) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is methyl 4-[[2-ethyl-2-(hydroxymethyl)butyl]amino]pyridine-2-carboxylate.
| Compound Name | methyl 4-[[2-ethyl-2-(hydroxymethyl)butyl]amino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 103844394 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | methyl 4-[[2-ethyl-2-(hydroxymethyl)butyl]amino]pyridine-2-carboxylate |
| SMILES | CCC(CC)(CO)CNc1ccnc(C(=O)OC)c1 |
| InChI | InChI=1S/C14H22N2O3/c1-4-14(5-2,10-17)9-16-11-6-7-15-12(8-11)13(18)19-3/h6-8,17H,4-5,9-10H2,1-3H3,(H,15,16) |
| InChIKey | LSTCBXOJPQCFSO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |