C15H23BrN2 — CID 103844980
N-[(2-bromo-4-methylphenyl)methyl]-N'-cyclopropyl-N'-ethylethane-1,2-diamine (PubChem CID 103844980) has the molecular formula C15H23BrN2 and a molecular weight of 311.27 g/mol. Its IUPAC name is N-[(2-bromo-4-methylphenyl)methyl]-N'-cyclopropyl-N'-ethylethane-1,2-diamine.
| Compound Name | N-[(2-bromo-4-methylphenyl)methyl]-N'-cyclopropyl-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 103844980 |
| Molecular Formula | C15H23BrN2 |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-[(2-bromo-4-methylphenyl)methyl]-N'-cyclopropyl-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CCNCc1ccc(C)cc1Br)C1CC1 |
| InChI | InChI=1S/C15H23BrN2/c1-3-18(14-6-7-14)9-8-17-11-13-5-4-12(2)10-15(13)16/h4-5,10,14,17H,3,6-9,11H2,1-2H3 |
| InChIKey | OHKUJSSARTVELE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|