C13H16BrN — CID 115978395
N-[(2-bromo-4-methylphenyl)methyl]pent-3-yn-1-amine (PubChem CID 115978395) has the molecular formula C13H16BrN and a molecular weight of 266.18 g/mol. Its IUPAC name is N-[(2-bromo-4-methylphenyl)methyl]pent-3-yn-1-amine.
| Compound Name | N-[(2-bromo-4-methylphenyl)methyl]pent-3-yn-1-amine |
|---|---|
| PubChem CID | 115978395 |
| Molecular Formula | C13H16BrN |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | N-[(2-bromo-4-methylphenyl)methyl]pent-3-yn-1-amine |
| SMILES | CC#CCCNCc1ccc(C)cc1Br |
| InChI | InChI=1S/C13H16BrN/c1-3-4-5-8-15-10-12-7-6-11(2)9-13(12)14/h6-7,9,15H,5,8,10H2,1-2H3 |
| InChIKey | BRZQZFMGAYHAGE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|