C12H19N3 — CID 103845310
2-(cyclopenten-1-yl)-N-[(3-methylimidazol-4-yl)methyl]ethanamine (PubChem CID 103845310) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 2-(cyclopenten-1-yl)-N-[(3-methylimidazol-4-yl)methyl]ethanamine.
| Compound Name | 2-(cyclopenten-1-yl)-N-[(3-methylimidazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103845310 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 2-(cyclopenten-1-yl)-N-[(3-methylimidazol-4-yl)methyl]ethanamine |
| SMILES | Cn1cncc1CNCCC1=CCCC1 |
| InChI | InChI=1S/C12H19N3/c1-15-10-14-9-12(15)8-13-7-6-11-4-2-3-5-11/h4,9-10,13H,2-3,5-8H2,1H3 |
| InChIKey | ZYVPILIJXJKKNW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|