C13H17FN2 — CID 104953880
2-(cyclopenten-1-yl)-N-[(5-fluoro-3-pyridinyl)methyl]ethanamine (PubChem CID 104953880) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is 2-(cyclopenten-1-yl)-N-[(5-fluoro-3-pyridinyl)methyl]ethanamine.
| Compound Name | 2-(cyclopenten-1-yl)-N-[(5-fluoro-3-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 104953880 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 2-(cyclopenten-1-yl)-N-[(5-fluoro-3-pyridinyl)methyl]ethanamine |
| SMILES | Fc1cncc(CNCCC2=CCCC2)c1 |
| InChI | InChI=1S/C13H17FN2/c14-13-7-12(9-16-10-13)8-15-6-5-11-3-1-2-4-11/h3,7,9-10,15H,1-2,4-6,8H2 |
| InChIKey | OHGYCGSRJPKSRE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|